C9H15NO — CID 70331344
1-[(6R)-2-methyl-2-azabicyclo[4.1.0]heptan-3-yl]ethanone (PubChem CID 70331344) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-[(6R)-2-methyl-2-azabicyclo[4.1.0]heptan-3-yl]ethanone.
| Compound Name | 1-[(6R)-2-methyl-2-azabicyclo[4.1.0]heptan-3-yl]ethanone |
|---|---|
| PubChem CID | 70331344 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-[(6R)-2-methyl-2-azabicyclo[4.1.0]heptan-3-yl]ethanone |
| SMILES | CC(=O)C1CC[C@@H]2CC2N1C |
| InChI | InChI=1S/C9H15NO/c1-6(11)8-4-3-7-5-9(7)10(8)2/h7-9H,3-5H2,1-2H3/t7-,8?,9?/m1/s1 |
| InChIKey | KMPGYHPVYZHIRY-AFPNSQJFSA-N |
| XLogP | 1.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |