C16H27NO4 — CID 14891193
tert-butyl (3S,4R)-4-acetyl-1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 14891193) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-acetyl-1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-acetyl-1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 14891193 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | tert-butyl (3S,4R)-4-acetyl-1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CC(=O)[C@@H]1C(=O)N(CC(C)(C)C)C[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO4/c1-10(18)12-11(14(20)21-16(5,6)7)8-17(13(12)19)9-15(2,3)4/h11-12H,8-9H2,1-7H3/t11-,12+/m1/s1 |
| InChIKey | FNHNLFNDPYVWJD-NEPJUHHUSA-N |
| XLogP | 2.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|