C9H11NO4S — CID 134920335
methyl (3S,5R,6S)-6-acetyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 134920335) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is methyl (3S,5R,6S)-6-acetyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | methyl (3S,5R,6S)-6-acetyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 134920335 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | methyl (3S,5R,6S)-6-acetyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN2C(=O)[C@H](C(C)=O)[C@H]2S1 |
| InChI | InChI=1S/C9H11NO4S/c1-4(11)6-7(12)10-3-5(9(13)14-2)15-8(6)10/h5-6,8H,3H2,1-2H3/t5-,6-,8+/m0/s1 |
| InChIKey | JQAZLDZWCZKUNK-VMHSAVOQSA-N |
| XLogP | -0.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|