C11H11I3N2O4 — CID 154239693
1,6-diacetyl-3,5-diamino-2,4,6-triiodocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 154239693) has the molecular formula C11H11I3N2O4 and a molecular weight of 615.93 g/mol. Its IUPAC name is 1,6-diacetyl-3,5-diamino-2,4,6-triiodocyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 1,6-diacetyl-3,5-diamino-2,4,6-triiodocyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 154239693 |
| Molecular Formula | C11H11I3N2O4 |
| Molecular Weight | 615.93 g/mol |
| Exact Mass | 615.79 |
| IUPAC Name | 1,6-diacetyl-3,5-diamino-2,4,6-triiodocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC(=O)C1(I)C(N)=C(I)C(N)=C(I)C1(C(C)=O)C(=O)O |
| InChI | InChI=1S/C11H11I3N2O4/c1-3(17)10(9(19)20)7(13)6(15)5(12)8(16)11(10,14)4(2)18/h15-16H2,1-2H3,(H,19,20) |
| InChIKey | LJLXDSVJKWDEQX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.93 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|