About acetic acid;triiodosamarium
acetic acid;triiodosamarium (PubChem CID 174886027) has the molecular formula C2H4I3O2Sm
and a molecular weight of 591.12 g/mol. Its IUPAC name is acetic acid;triiodosamarium.
Molecular Properties
| Compound Name | acetic acid;triiodosamarium |
| PubChem CID | 174886027 |
| Molecular Formula | C2H4I3O2Sm |
| Molecular Weight | 591.12 g/mol |
| Exact Mass | 592.65 |
| IUPAC Name | acetic acid;triiodosamarium |
| SMILES | CC(=O)O.I[Sm](I)I |
| InChI | InChI=1S/C2H4O2.3HI.Sm/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/q;;;;+3/p-3 |
| InChIKey | SRQNSGIUCVWCGJ-UHFFFAOYSA-K |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 591.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;triiodosamarium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;triiodosamarium?
The IUPAC name of acetic acid;triiodosamarium (CID 174886027) is acetic acid;triiodosamarium.
What is the SMILES notation for acetic acid;triiodosamarium?
The canonical SMILES for acetic acid;triiodosamarium is CC(=O)O.I[Sm](I)I.
What is the InChIKey of acetic acid;triiodosamarium?
The InChIKey is SRQNSGIUCVWCGJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H4O2.3HI.Sm/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/q;;;;+3/p-3.
What are the key properties of acetic acid;triiodosamarium?
acetic acid;triiodosamarium has a molecular weight of 591.12 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;triiodosamarium is sourced from PubChem (CID 174886027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).