About C2H6MgO3
C2H6MgO3 (PubChem CID 45051722) has the molecular formula C2H6MgO3
and a molecular weight of 102.37 g/mol.
Molecular Properties
| Compound Name | C2H6MgO3 |
| PubChem CID | 45051722 |
| Molecular Formula | C2H6MgO3 |
| Molecular Weight | 102.37 g/mol |
| Exact Mass | 102.02 |
| IUPAC Name | — |
| SMILES | CC(=O)O.O.[Mg] |
| InChI | InChI=1S/C2H4O2.Mg.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2 |
| InChIKey | IONBZDGFUXRXLQ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.37 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze C2H6MgO3 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of C2H6MgO3?
The IUPAC name of C2H6MgO3 (CID 45051722) is not available.
What is the SMILES notation for C2H6MgO3?
The canonical SMILES for C2H6MgO3 is CC(=O)O.O.[Mg].
What is the InChIKey of C2H6MgO3?
The InChIKey is IONBZDGFUXRXLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.Mg.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2.
What are the key properties of C2H6MgO3?
C2H6MgO3 has a molecular weight of 102.37 g/mol, XLogP of -1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for C2H6MgO3 is sourced from PubChem (CID 45051722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).