C7H14N6O2 — CID 157396052
formaldehyde;propan-2-one;1,3,5-triazine-2,4,6-triamine (PubChem CID 157396052) has the molecular formula C7H14N6O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is formaldehyde;propan-2-one;1,3,5-triazine-2,4,6-triamine.
| Compound Name | formaldehyde;propan-2-one;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 157396052 |
| Molecular Formula | C7H14N6O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | formaldehyde;propan-2-one;1,3,5-triazine-2,4,6-triamine |
| SMILES | C=O.CC(C)=O.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C3H6N6.C3H6O.CH2O/c4-1-7-2(5)9-3(6)8-1;1-3(2)4;1-2/h(H6,4,5,6,7,8,9);1-2H3;1H2 |
| InChIKey | BMOUYZCTOOEOOS-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |