C11H12N2O7 — CID 142654327
4,5,5-triacetyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid (PubChem CID 142654327) has the molecular formula C11H12N2O7 and a molecular weight of 284.22 g/mol. Its IUPAC name is 4,5,5-triacetyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid.
| Compound Name | 4,5,5-triacetyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 142654327 |
| Molecular Formula | C11H12N2O7 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4,5,5-triacetyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
| SMILES | CC(=O)C1(C(=O)O)NC(=O)NC(=O)C1(C(C)=O)C(C)=O |
| InChI | InChI=1S/C11H12N2O7/c1-4(14)10(5(2)15)7(17)12-9(20)13-11(10,6(3)16)8(18)19/h1-3H3,(H,18,19)(H2,12,13,17,20) |
| InChIKey | DCVFNQFIZAOAGF-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 146.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|