C13H20N2O6 — CID 22139635
ditert-butyl 2,5-dioxoimidazolidine-4,4-dicarboxylate (PubChem CID 22139635) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is ditert-butyl 2,5-dioxoimidazolidine-4,4-dicarboxylate.
| Compound Name | ditert-butyl 2,5-dioxoimidazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 22139635 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | ditert-butyl 2,5-dioxoimidazolidine-4,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)OC(C)(C)C)NC(=O)NC1=O |
| InChI | InChI=1S/C13H20N2O6/c1-11(2,3)20-8(17)13(7(16)14-10(19)15-13)9(18)21-12(4,5)6/h1-6H3,(H2,14,15,16,19) |
| InChIKey | HPPMDXOUISVKNA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|