C13H18N4O5 — CID 175802307
tert-butyl N-[[(4R)-4-(4-methyl-1,2-oxazol-5-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate (PubChem CID 175802307) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is tert-butyl N-[[(4R)-4-(4-methyl-1,2-oxazol-5-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(4R)-4-(4-methyl-1,2-oxazol-5-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 175802307 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | tert-butyl N-[[(4R)-4-(4-methyl-1,2-oxazol-5-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate |
| SMILES | Cc1cnoc1[C@@]1(CNC(=O)OC(C)(C)C)NC(=O)NC1=O |
| InChI | InChI=1S/C13H18N4O5/c1-7-5-15-22-8(7)13(9(18)16-10(19)17-13)6-14-11(20)21-12(2,3)4/h5H,6H2,1-4H3,(H,14,20)(H2,16,17,18,19)/t13-/m1/s1 |
| InChIKey | ZJTQMIUNUITMEX-CYBMUJFWSA-N |
| XLogP | 0.54 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|