C20H28N2O4 — CID 22414859
tert-butyl N-[(2,5,8,8-tetramethyl-7-oxo-3,6-dihydrofuro[2,3-e]indol-2-yl)methyl]carbamate (PubChem CID 22414859) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is tert-butyl N-[(2,5,8,8-tetramethyl-7-oxo-3,6-dihydrofuro[2,3-e]indol-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2,5,8,8-tetramethyl-7-oxo-3,6-dihydrofuro[2,3-e]indol-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 22414859 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl N-[(2,5,8,8-tetramethyl-7-oxo-3,6-dihydrofuro[2,3-e]indol-2-yl)methyl]carbamate |
| SMILES | Cc1cc2c(c3c1NC(=O)C3(C)C)OC(C)(CNC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C20H28N2O4/c1-11-8-12-9-20(7,10-21-17(24)26-18(2,3)4)25-15(12)13-14(11)22-16(23)19(13,5)6/h8H,9-10H2,1-7H3,(H,21,24)(H,22,23) |
| InChIKey | KOKAYVSZOHGKDB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |