C14H21N5O4 — CID 156688917
tert-butyl N-[[4-(3,5-dimethylimidazol-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate (PubChem CID 156688917) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is tert-butyl N-[[4-(3,5-dimethylimidazol-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(3,5-dimethylimidazol-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 156688917 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl N-[[4-(3,5-dimethylimidazol-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]carbamate |
| SMILES | Cc1ncn(C)c1C1(CNC(=O)OC(C)(C)C)NC(=O)NC1=O |
| InChI | InChI=1S/C14H21N5O4/c1-8-9(19(5)7-16-8)14(10(20)17-11(21)18-14)6-15-12(22)23-13(2,3)4/h7H,6H2,1-5H3,(H,15,22)(H2,17,18,20,21) |
| InChIKey | JHBZWGBLXYKMSH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|