C12H16N4O4S — CID 175783252
tert-butyl N-[[(4R)-2,5-dioxo-4-(1,3-thiazol-4-yl)imidazolidin-4-yl]methyl]carbamate (PubChem CID 175783252) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is tert-butyl N-[[(4R)-2,5-dioxo-4-(1,3-thiazol-4-yl)imidazolidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(4R)-2,5-dioxo-4-(1,3-thiazol-4-yl)imidazolidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 175783252 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | tert-butyl N-[[(4R)-2,5-dioxo-4-(1,3-thiazol-4-yl)imidazolidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@]1(c2cscn2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H16N4O4S/c1-11(2,3)20-10(19)13-5-12(7-4-21-6-14-7)8(17)15-9(18)16-12/h4,6H,5H2,1-3H3,(H,13,19)(H2,15,16,17,18)/t12-/m1/s1 |
| InChIKey | OXKPVGZDAHIUGS-GFCCVEGCSA-N |
| XLogP | 0.70 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|