C13H21N3O6 — CID 118541132
tert-butyl N-hydroxy-N-[5-(2-methylpropyl)-2,4,6-trioxo-1,3-diazinan-5-yl]carbamate (PubChem CID 118541132) has the molecular formula C13H21N3O6 and a molecular weight of 315.33 g/mol. Its IUPAC name is tert-butyl N-hydroxy-N-[5-(2-methylpropyl)-2,4,6-trioxo-1,3-diazinan-5-yl]carbamate.
| Compound Name | tert-butyl N-hydroxy-N-[5-(2-methylpropyl)-2,4,6-trioxo-1,3-diazinan-5-yl]carbamate |
|---|---|
| PubChem CID | 118541132 |
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | tert-butyl N-hydroxy-N-[5-(2-methylpropyl)-2,4,6-trioxo-1,3-diazinan-5-yl]carbamate |
| SMILES | CC(C)CC1(N(O)C(=O)OC(C)(C)C)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C13H21N3O6/c1-7(2)6-13(8(17)14-10(19)15-9(13)18)16(21)11(20)22-12(3,4)5/h7,21H,6H2,1-5H3,(H2,14,15,17,18,19) |
| InChIKey | MBWWTHMWNVSLMO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|