C7H7FN2O4 — CID 155895138
2-fluoro-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid (PubChem CID 155895138) has the molecular formula C7H7FN2O4 and a molecular weight of 202.14 g/mol. Its IUPAC name is 2-fluoro-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid.
| Compound Name | 2-fluoro-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 155895138 |
| Molecular Formula | C7H7FN2O4 |
| Molecular Weight | 202.14 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-fluoro-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid |
| SMILES | O=C1NC(=O)C2(CC(F)(C(=O)O)C2)N1 |
| InChI | InChI=1S/C7H7FN2O4/c8-6(4(12)13)1-7(2-6)3(11)9-5(14)10-7/h1-2H2,(H,12,13)(H2,9,10,11,14) |
| InChIKey | FXKOCVKBUAWROZ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.14 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|