C8H9N2O4- — CID 78445633
2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylate (PubChem CID 78445633) has the molecular formula C8H9N2O4- and a molecular weight of 197.17 g/mol. Its IUPAC name is 2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylate.
| Compound Name | 2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 78445633 |
| Molecular Formula | C8H9N2O4- |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylate |
| SMILES | O=C1NC(=O)C2(CCC(C(=O)[O-])C2)N1 |
| InChI | InChI=1S/C8H10N2O4/c11-5(12)4-1-2-8(3-4)6(13)9-7(14)10-8/h4H,1-3H2,(H,11,12)(H2,9,10,13,14)/p-1 |
| InChIKey | IDLOULSKJDVSKX-UHFFFAOYSA-M |
| XLogP | -1.89 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|