C12H18N4O3 — CID 63005449
8-(pyrrolidine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 63005449) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 8-(pyrrolidine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(pyrrolidine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 63005449 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 8-(pyrrolidine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)C3CCNC3)CC2)N1 |
| InChI | InChI=1S/C12H18N4O3/c17-9(8-1-4-13-7-8)16-5-2-12(3-6-16)10(18)14-11(19)15-12/h8,13H,1-7H2,(H2,14,15,18,19) |
| InChIKey | OMLWXEANDBPMMQ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|