C11H15N3O3 — CID 129354111
(3aS,6aR)-5-[(3R)-pyrrolidine-3-carbonyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione (PubChem CID 129354111) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is (3aS,6aR)-5-[(3R)-pyrrolidine-3-carbonyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione.
| Compound Name | (3aS,6aR)-5-[(3R)-pyrrolidine-3-carbonyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 129354111 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (3aS,6aR)-5-[(3R)-pyrrolidine-3-carbonyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
| SMILES | O=C1NC(=O)[C@@H]2CN(C(=O)[C@@H]3CCNC3)C[C@H]12 |
| InChI | InChI=1S/C11H15N3O3/c15-9-7-4-14(5-8(7)10(16)13-9)11(17)6-1-2-12-3-6/h6-8,12H,1-5H2,(H,13,15,16)/t6-,7-,8+/m1/s1 |
| InChIKey | JDNKQPIQABBLHW-PRJMDXOYSA-N |
| XLogP | -1.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|