C10H19N3O — CID 94915356
(4-methylpiperazin-1-yl)-[(3R)-pyrrolidin-3-yl]methanone (PubChem CID 94915356) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[(3R)-pyrrolidin-3-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[(3R)-pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 94915356 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[(3R)-pyrrolidin-3-yl]methanone |
| SMILES | CN1CCN(C(=O)[C@@H]2CCNC2)CC1 |
| InChI | InChI=1S/C10H19N3O/c1-12-4-6-13(7-5-12)10(14)9-2-3-11-8-9/h9,11H,2-8H2,1H3/t9-/m1/s1 |
| InChIKey | RUVBKIPDBYYZBN-SECBINFHSA-N |
| XLogP | -0.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |