C13H27N3O — CID 176554643
ethane;(4-methylpiperazin-1-yl)-piperidin-4-ylmethanone (PubChem CID 176554643) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is ethane;(4-methylpiperazin-1-yl)-piperidin-4-ylmethanone.
| Compound Name | ethane;(4-methylpiperazin-1-yl)-piperidin-4-ylmethanone |
|---|---|
| PubChem CID | 176554643 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | ethane;(4-methylpiperazin-1-yl)-piperidin-4-ylmethanone |
| SMILES | CC.CN1CCN(C(=O)C2CCNCC2)CC1 |
| InChI | InChI=1S/C11H21N3O.C2H6/c1-13-6-8-14(9-7-13)11(15)10-2-4-12-5-3-10;1-2/h10,12H,2-9H2,1H3;1-2H3 |
| InChIKey | VZBWUPABKRPDEL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |