C13H19N3O4 — CID 114826313
8-(5-methyloxolane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 114826313) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 8-(5-methyloxolane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(5-methyloxolane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 114826313 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 8-(5-methyloxolane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CC(C(=O)N2CCC3(CC2)NC(=O)NC3=O)CO1 |
| InChI | InChI=1S/C13H19N3O4/c1-8-6-9(7-20-8)10(17)16-4-2-13(3-5-16)11(18)14-12(19)15-13/h8-9H,2-7H2,1H3,(H2,14,15,18,19) |
| InChIKey | XDGMICGSVRDWPE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|