C16H17N3O5 — CID 42940741
8-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 42940741) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 8-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 42940741 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 8-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)C3COc4ccccc4O3)CC2)N1 |
| InChI | InChI=1S/C16H17N3O5/c20-13(12-9-23-10-3-1-2-4-11(10)24-12)19-7-5-16(6-8-19)14(21)17-15(22)18-16/h1-4,12H,5-9H2,(H2,17,18,21,22) |
| InChIKey | DKHLFSFMLXSURA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|