C19H21Cl2N3O3 — CID 170580794
N-[cyclopentyl-(3,4-dichlorophenyl)methyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide (PubChem CID 170580794) has the molecular formula C19H21Cl2N3O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is N-[cyclopentyl-(3,4-dichlorophenyl)methyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide.
| Compound Name | N-[cyclopentyl-(3,4-dichlorophenyl)methyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide |
|---|---|
| PubChem CID | 170580794 |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[cyclopentyl-(3,4-dichlorophenyl)methyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide |
| SMILES | O=C1NC(=O)C2(CC(C(=O)NC(c3ccc(Cl)c(Cl)c3)C3CCCC3)C2)N1 |
| InChI | InChI=1S/C19H21Cl2N3O3/c20-13-6-5-11(7-14(13)21)15(10-3-1-2-4-10)22-16(25)12-8-19(9-12)17(26)23-18(27)24-19/h5-7,10,12,15H,1-4,8-9H2,(H,22,25)(H2,23,24,26,27) |
| InChIKey | KIFFXURWJMXEON-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|