C20H22ClN3O5 — CID 170330265
2-(3-chlorophenyl)-2-cyclopentyl-2-[(6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carbonyl)amino]acetic acid (PubChem CID 170330265) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-cyclopentyl-2-[(6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carbonyl)amino]acetic acid.
| Compound Name | 2-(3-chlorophenyl)-2-cyclopentyl-2-[(6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 170330265 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-(3-chlorophenyl)-2-cyclopentyl-2-[(6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carbonyl)amino]acetic acid |
| SMILES | O=C1NC(=O)C2(CC(C(=O)NC(C(=O)O)(c3cccc(Cl)c3)C3CCCC3)C2)N1 |
| InChI | InChI=1S/C20H22ClN3O5/c21-14-7-3-6-13(8-14)20(17(27)28,12-4-1-2-5-12)23-15(25)11-9-19(10-11)16(26)22-18(29)24-19/h3,6-8,11-12H,1-2,4-5,9-10H2,(H,23,25)(H,27,28)(H2,22,24,26,29) |
| InChIKey | UUZXUZYENNEUKO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|