C26H35ClN2O2 — CID 90786978
tert-butyl N-[(3-chlorophenyl)-cyclohexyl-(2-phenylethylamino)methyl]carbamate (PubChem CID 90786978) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is tert-butyl N-[(3-chlorophenyl)-cyclohexyl-(2-phenylethylamino)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-chlorophenyl)-cyclohexyl-(2-phenylethylamino)methyl]carbamate |
|---|---|
| PubChem CID | 90786978 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | tert-butyl N-[(3-chlorophenyl)-cyclohexyl-(2-phenylethylamino)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(NCCc1ccccc1)(c1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H35ClN2O2/c1-25(2,3)31-24(30)29-26(21-13-8-5-9-14-21,22-15-10-16-23(27)19-22)28-18-17-20-11-6-4-7-12-20/h4,6-7,10-12,15-16,19,21,28H,5,8-9,13-14,17-18H2,1-3H3,(H,29,30) |
| InChIKey | SEGMYLJCBQUDKU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|