C19H29ClN2O2 — CID 113242210
tert-butyl N-[[2-[(3-chlorophenyl)methylamino]cyclohexyl]methyl]carbamate (PubChem CID 113242210) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is tert-butyl N-[[2-[(3-chlorophenyl)methylamino]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[(3-chlorophenyl)methylamino]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 113242210 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl N-[[2-[(3-chlorophenyl)methylamino]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCC1NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H29ClN2O2/c1-19(2,3)24-18(23)22-13-15-8-4-5-10-17(15)21-12-14-7-6-9-16(20)11-14/h6-7,9,11,15,17,21H,4-5,8,10,12-13H2,1-3H3,(H,22,23) |
| InChIKey | VUIYFIUPAVPIJH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |