C19H27N3O2 — CID 113242252
tert-butyl N-[[2-[(4-cyanophenyl)methylamino]cyclopentyl]methyl]carbamate (PubChem CID 113242252) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl N-[[2-[(4-cyanophenyl)methylamino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[(4-cyanophenyl)methylamino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 113242252 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | tert-butyl N-[[2-[(4-cyanophenyl)methylamino]cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1NCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H27N3O2/c1-19(2,3)24-18(23)22-13-16-5-4-6-17(16)21-12-15-9-7-14(11-20)8-10-15/h7-10,16-17,21H,4-6,12-13H2,1-3H3,(H,22,23) |
| InChIKey | COSHICFVYVQITD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |