C20H21ClN4O3 — CID 170330187
N-[(R)-(3-chlorophenyl)-cyano-cyclopentylmethyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide (PubChem CID 170330187) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is N-[(R)-(3-chlorophenyl)-cyano-cyclopentylmethyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide.
| Compound Name | N-[(R)-(3-chlorophenyl)-cyano-cyclopentylmethyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide |
|---|---|
| PubChem CID | 170330187 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[(R)-(3-chlorophenyl)-cyano-cyclopentylmethyl]-6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxamide |
| SMILES | N#C[C@](NC(=O)C1CC2(C1)NC(=O)NC2=O)(c1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C20H21ClN4O3/c21-15-7-3-6-14(8-15)20(11-22,13-4-1-2-5-13)24-16(26)12-9-19(10-12)17(27)23-18(28)25-19/h3,6-8,12-13H,1-2,4-5,9-10H2,(H,24,26)(H2,23,25,27,28)/t12?,19?,20-/m1/s1 |
| InChIKey | DLCAJFWGMMWYGU-YJJFLIPZSA-N |
| XLogP | 2.35 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|