C17H23ClN2O — CID 170580293
3-amino-N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]cyclobutane-1-carboxamide (PubChem CID 170580293) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 3-amino-N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]cyclobutane-1-carboxamide.
| Compound Name | 3-amino-N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 170580293 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-amino-N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]cyclobutane-1-carboxamide |
| SMILES | NC1CC(C(=O)N[C@H](c2cccc(Cl)c2)C2CCCC2)C1 |
| InChI | InChI=1S/C17H23ClN2O/c18-14-7-3-6-12(8-14)16(11-4-1-2-5-11)20-17(21)13-9-15(19)10-13/h3,6-8,11,13,15-16H,1-2,4-5,9-10,19H2,(H,20,21)/t13?,15?,16-/m0/s1 |
| InChIKey | SQCKECQZZNTFJA-BCLQGDPASA-N |
| XLogP | 3.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |