C20H24Cl2N2O — CID 119736446
3-amino-N-[(3-chlorophenyl)-phenylmethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119736446) has the molecular formula C20H24Cl2N2O and a molecular weight of 379.33 g/mol. Its IUPAC name is 3-amino-N-[(3-chlorophenyl)-phenylmethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[(3-chlorophenyl)-phenylmethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119736446 |
| Molecular Formula | C20H24Cl2N2O |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-amino-N-[(3-chlorophenyl)-phenylmethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)NC(c2ccccc2)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H23ClN2O.ClH/c21-17-10-4-8-15(12-17)19(14-6-2-1-3-7-14)23-20(24)16-9-5-11-18(22)13-16;/h1-4,6-8,10,12,16,18-19H,5,9,11,13,22H2,(H,23,24);1H |
| InChIKey | WVDJGHAGBHCIAV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |