C20H27ClN2O — CID 170580686
N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-5-azaspiro[3.4]octane-2-carboxamide (PubChem CID 170580686) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-5-azaspiro[3.4]octane-2-carboxamide.
| Compound Name | N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-5-azaspiro[3.4]octane-2-carboxamide |
|---|---|
| PubChem CID | 170580686 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-5-azaspiro[3.4]octane-2-carboxamide |
| SMILES | O=C(N[C@H](c1cccc(Cl)c1)C1CCCC1)C1CC2(CCCN2)C1 |
| InChI | InChI=1S/C20H27ClN2O/c21-17-8-3-7-15(11-17)18(14-5-1-2-6-14)23-19(24)16-12-20(13-16)9-4-10-22-20/h3,7-8,11,14,16,18,22H,1-2,4-6,9-10,12-13H2,(H,23,24)/t16?,18-,20?/m0/s1 |
| InChIKey | XMMURAYWVMEDSM-IPCDKGFNSA-N |
| XLogP | 4.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |