C16H22N4O3S — CID 167850869
N-(5-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 167850869) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(5-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 167850869 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-(5-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | CC(C)(C)c1cnc(NC(=O)C2CCC3(CC2)NC(=O)NC3=O)s1 |
| InChI | InChI=1S/C16H22N4O3S/c1-15(2,3)10-8-17-14(24-10)18-11(21)9-4-6-16(7-5-9)12(22)19-13(23)20-16/h8-9H,4-7H2,1-3H3,(H,17,18,21)(H2,19,20,22,23) |
| InChIKey | KEBLTYNWFNGGLM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|