C11H12N4O4 — CID 44552395
2,4,11,13-tetrazatrispiro[4.1.1.49.17.15]pentadecane-1,3,10,12-tetrone (PubChem CID 44552395) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2,4,11,13-tetrazatrispiro[4.1.1.49.17.15]pentadecane-1,3,10,12-tetrone.
| Compound Name | 2,4,11,13-tetrazatrispiro[4.1.1.49.17.15]pentadecane-1,3,10,12-tetrone |
|---|---|
| PubChem CID | 44552395 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2,4,11,13-tetrazatrispiro[4.1.1.49.17.15]pentadecane-1,3,10,12-tetrone |
| SMILES | O=C1NC(=O)C2(CC3(C2)CC2(C3)NC(=O)NC2=O)N1 |
| InChI | InChI=1S/C11H12N4O4/c16-5-10(14-7(18)12-5)1-9(2-10)3-11(4-9)6(17)13-8(19)15-11/h1-4H2,(H2,12,14,16,18)(H2,13,15,17,19) |
| InChIKey | KBVSOFRQMDPAQD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|