About 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione
7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 4868343) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
Molecular Properties
| Compound Name | 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| PubChem CID | 4868343 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCSC2)N1 |
| InChI | InChI=1S/C6H8N2O2S/c9-4-6(1-2-11-3-6)8-5(10)7-4/h1-3H2,(H2,7,8,9,10) |
| InChIKey | MDNCSTBDLRSGIJ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione?
The IUPAC name of 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (CID 4868343) is 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
What is the SMILES notation for 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione?
The canonical SMILES for 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione is O=C1NC(=O)C2(CCSC2)N1.
What is the InChIKey of 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione?
The InChIKey is MDNCSTBDLRSGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c9-4-6(1-2-11-3-6)8-5(10)7-4/h1-3H2,(H2,7,8,9,10).
What are the key properties of 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione?
7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione has a molecular weight of 172.21 g/mol, XLogP of -0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione is sourced from PubChem (CID 4868343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).