C6H8N2O2S — CID 4868343
7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 4868343) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 4868343 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCSC2)N1 |
| InChI | InChI=1S/C6H8N2O2S/c9-4-6(1-2-11-3-6)8-5(10)7-4/h1-3H2,(H2,7,8,9,10) |
| InChIKey | MDNCSTBDLRSGIJ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|