C8H10O4S — CID 89248975
(3S)-3-acetylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid (PubChem CID 89248975) has the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. Its IUPAC name is (3S)-3-acetylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid.
| Compound Name | (3S)-3-acetylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 89248975 |
| Molecular Formula | C8H10O4S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | (3S)-3-acetylsulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid |
| SMILES | CC(=O)S[C@@H]1COCC=C1C(=O)O |
| InChI | InChI=1S/C8H10O4S/c1-5(9)13-7-4-12-3-2-6(7)8(10)11/h2,7H,3-4H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | NRVXAFTVBPEQDY-SSDOTTSWSA-N |
| XLogP | 0.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|