C21H20O4 — CID 88797547
3-(1-phenylprop-2-enoxy)oxolane-2,5-dione;styrene (PubChem CID 88797547) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-(1-phenylprop-2-enoxy)oxolane-2,5-dione;styrene.
| Compound Name | 3-(1-phenylprop-2-enoxy)oxolane-2,5-dione;styrene |
|---|---|
| PubChem CID | 88797547 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-(1-phenylprop-2-enoxy)oxolane-2,5-dione;styrene |
| SMILES | C=CC(OC1CC(=O)OC1=O)c1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C13H12O4.C8H8/c1-2-10(9-6-4-3-5-7-9)16-11-8-12(14)17-13(11)15;1-2-8-6-4-3-5-7-8/h2-7,10-11H,1,8H2;2-7H,1H2 |
| InChIKey | JVAAASGKVREKDR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|