C6H9NO2 — CID 45078781
(3S,5E)-3-amino-5-ethylideneoxolan-2-one (PubChem CID 45078781) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (3S,5E)-3-amino-5-ethylideneoxolan-2-one.
| Compound Name | (3S,5E)-3-amino-5-ethylideneoxolan-2-one |
|---|---|
| PubChem CID | 45078781 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (3S,5E)-3-amino-5-ethylideneoxolan-2-one |
| SMILES | C/C=C1\C[C@H](N)C(=O)O1 |
| InChI | InChI=1S/C6H9NO2/c1-2-4-3-5(7)6(8)9-4/h2,5H,3,7H2,1H3/b4-2+/t5-/m0/s1 |
| InChIKey | DCHWAFCIPYWBGO-FYTLMZHYSA-N |
| XLogP | 0.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |