C6H8O2 — CID 134893121
(3R,4E)-4-ethylidene-3-methyloxetan-2-one (PubChem CID 134893121) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is (3R,4E)-4-ethylidene-3-methyloxetan-2-one.
| Compound Name | (3R,4E)-4-ethylidene-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 134893121 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | (3R,4E)-4-ethylidene-3-methyloxetan-2-one |
| SMILES | C/C=C1/OC(=O)[C@@H]1C |
| InChI | InChI=1S/C6H8O2/c1-3-5-4(2)6(7)8-5/h3-4H,1-2H3/b5-3+/t4-/m1/s1 |
| InChIKey | CMSUQAHYZQWEKF-OFWOHVDASA-N |
| XLogP | 1.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|