C4H4O4S — CID 90716489
5-methyl-1,3,2-dioxathiane-4,6-dione (PubChem CID 90716489) has the molecular formula C4H4O4S and a molecular weight of 148.14 g/mol. Its IUPAC name is 5-methyl-1,3,2-dioxathiane-4,6-dione.
| Compound Name | 5-methyl-1,3,2-dioxathiane-4,6-dione |
|---|---|
| PubChem CID | 90716489 |
| Molecular Formula | C4H4O4S |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 147.98 |
| IUPAC Name | 5-methyl-1,3,2-dioxathiane-4,6-dione |
| SMILES | CC1C(=O)OSOC1=O |
| InChI | InChI=1S/C4H4O4S/c1-2-3(5)7-9-8-4(2)6/h2H,1H3 |
| InChIKey | SGOLEWBZCZXCAW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|