C5H7BO4 — CID 142048534
2,5-dimethyl-1,3,2-dioxaborinane-4,6-dione (PubChem CID 142048534) has the molecular formula C5H7BO4 and a molecular weight of 141.92 g/mol. Its IUPAC name is 2,5-dimethyl-1,3,2-dioxaborinane-4,6-dione.
| Compound Name | 2,5-dimethyl-1,3,2-dioxaborinane-4,6-dione |
|---|---|
| PubChem CID | 142048534 |
| Molecular Formula | C5H7BO4 |
| Molecular Weight | 141.92 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 2,5-dimethyl-1,3,2-dioxaborinane-4,6-dione |
| SMILES | CB1OC(=O)C(C)C(=O)O1 |
| InChI | InChI=1S/C5H7BO4/c1-3-4(7)9-6(2)10-5(3)8/h3H,1-2H3 |
| InChIKey | QUGHKTSOLSCMMQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.92 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|