C8H10O4 — CID 146553663
(3Z,6Z)-3,6-di(ethylidene)-5-hydroxy-1,4-dioxan-2-one (PubChem CID 146553663) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (3Z,6Z)-3,6-di(ethylidene)-5-hydroxy-1,4-dioxan-2-one.
| Compound Name | (3Z,6Z)-3,6-di(ethylidene)-5-hydroxy-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 146553663 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (3Z,6Z)-3,6-di(ethylidene)-5-hydroxy-1,4-dioxan-2-one |
| SMILES | C/C=C1\OC(O)/C(=C/C)OC1=O |
| InChI | InChI=1S/C8H10O4/c1-3-5-7(9)12-6(4-2)8(10)11-5/h3-4,7,9H,1-2H3/b5-3-,6-4- |
| InChIKey | NBGBFAYYPKXZLS-GLIMQPGKSA-N |
| XLogP | 0.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|