About 3-ethylideneoxiran-2-ol
3-ethylideneoxiran-2-ol (PubChem CID 123227088) has the molecular formula C4H6O2
and a molecular weight of 86.09 g/mol. Its IUPAC name is 3-ethylideneoxiran-2-ol.
Molecular Properties
| Compound Name | 3-ethylideneoxiran-2-ol |
| PubChem CID | 123227088 |
| Molecular Formula | C4H6O2 |
| Molecular Weight | 86.09 g/mol |
| Exact Mass | 86.04 |
| IUPAC Name | 3-ethylideneoxiran-2-ol |
| SMILES | CC=C1OC1O |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6-3/h2,4-5H,1H3 |
| InChIKey | FSSFSKXMAGWUAR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.09 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylideneoxiran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylideneoxiran-2-ol?
The IUPAC name of 3-ethylideneoxiran-2-ol (CID 123227088) is 3-ethylideneoxiran-2-ol.
What is the SMILES notation for 3-ethylideneoxiran-2-ol?
The canonical SMILES for 3-ethylideneoxiran-2-ol is CC=C1OC1O.
What is the InChIKey of 3-ethylideneoxiran-2-ol?
The InChIKey is FSSFSKXMAGWUAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2/c1-2-3-4(5)6-3/h2,4-5H,1H3.
What are the key properties of 3-ethylideneoxiran-2-ol?
3-ethylideneoxiran-2-ol has a molecular weight of 86.09 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylideneoxiran-2-ol is sourced from PubChem (CID 123227088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).