C21H56O3 — CID 159205301
methane;3-(3-methylheptan-2-yl)oxolane-2,5-dione (PubChem CID 159205301) has the molecular formula C21H56O3 and a molecular weight of 356.68 g/mol. Its IUPAC name is methane;3-(3-methylheptan-2-yl)oxolane-2,5-dione.
| Compound Name | methane;3-(3-methylheptan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 159205301 |
| Molecular Formula | C21H56O3 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 356.42 |
| IUPAC Name | methane;3-(3-methylheptan-2-yl)oxolane-2,5-dione |
| SMILES | C.C.C.C.C.C.C.C.C.CCCCC(C)C(C)C1CC(=O)OC1=O |
| InChI | InChI=1S/C12H20O3.9CH4/c1-4-5-6-8(2)9(3)10-7-11(13)15-12(10)14;;;;;;;;;/h8-10H,4-7H2,1-3H3;9*1H4 |
| InChIKey | KPUOLOLUDQXNTC-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|