C7H10O6 — CID 139795813
3-(1,2,3-trihydroxypropyl)oxolane-2,5-dione (PubChem CID 139795813) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is 3-(1,2,3-trihydroxypropyl)oxolane-2,5-dione.
| Compound Name | 3-(1,2,3-trihydroxypropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 139795813 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 3-(1,2,3-trihydroxypropyl)oxolane-2,5-dione |
| SMILES | O=C1CC(C(O)C(O)CO)C(=O)O1 |
| InChI | InChI=1S/C7H10O6/c8-2-4(9)6(11)3-1-5(10)13-7(3)12/h3-4,6,8-9,11H,1-2H2 |
| InChIKey | CRRQOWUKOWHJRN-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|