C8H10F2O3 — CID 121369308
3-(3,3-difluorobutan-2-yl)oxolane-2,5-dione (PubChem CID 121369308) has the molecular formula C8H10F2O3 and a molecular weight of 192.16 g/mol. Its IUPAC name is 3-(3,3-difluorobutan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-(3,3-difluorobutan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 121369308 |
| Molecular Formula | C8H10F2O3 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-(3,3-difluorobutan-2-yl)oxolane-2,5-dione |
| SMILES | CC(C1CC(=O)OC1=O)C(C)(F)F |
| InChI | InChI=1S/C8H10F2O3/c1-4(8(2,9)10)5-3-6(11)13-7(5)12/h4-5H,3H2,1-2H3 |
| InChIKey | VJZBDXPAWYAYIM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|