About [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate
[2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate (PubChem CID 23561922) has the molecular formula C16H26O5
and a molecular weight of 298.38 g/mol. Its IUPAC name is [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate |
| PubChem CID | 23561922 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(C)(CC(C)(C)C)C1CC(=O)OC1=O |
| InChI | InChI=1S/C16H26O5/c1-7-10(2)13(18)21-16(6,9-15(3,4)5)11-8-12(17)20-14(11)19/h10-11H,7-9H2,1-6H3 |
| InChIKey | CXTIVIZSIGAHQP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate?
The IUPAC name of [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate (CID 23561922) is [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate.
What is the SMILES notation for [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate?
The canonical SMILES for [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate is CCC(C)C(=O)OC(C)(CC(C)(C)C)C1CC(=O)OC1=O.
What is the InChIKey of [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate?
The InChIKey is CXTIVIZSIGAHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O5/c1-7-10(2)13(18)21-16(6,9-15(3,4)5)11-8-12(17)20-14(11)19/h10-11H,7-9H2,1-6H3.
What are the key properties of [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate?
[2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate has a molecular weight of 298.38 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dioxooxolan-3-yl)-4,4-dimethylpentan-2-yl] 2-methylbutanoate is sourced from PubChem (CID 23561922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).