C28H54O12 — CID 88505275
1,1,2-triethoxyheptoxycarbonyloxy 1,1,2-triethoxyheptyl carbonate (PubChem CID 88505275) has the molecular formula C28H54O12 and a molecular weight of 582.73 g/mol. Its IUPAC name is 1,1,2-triethoxyheptoxycarbonyloxy 1,1,2-triethoxyheptyl carbonate.
| Compound Name | 1,1,2-triethoxyheptoxycarbonyloxy 1,1,2-triethoxyheptyl carbonate |
|---|---|
| PubChem CID | 88505275 |
| Molecular Formula | C28H54O12 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | 1,1,2-triethoxyheptoxycarbonyloxy 1,1,2-triethoxyheptyl carbonate |
| SMILES | CCCCCC(OCC)C(OCC)(OCC)OC(=O)OOC(=O)OC(OCC)(OCC)C(CCCCC)OCC |
| InChI | InChI=1S/C28H54O12/c1-9-17-19-21-23(31-11-3)27(33-13-5,34-14-6)37-25(29)39-40-26(30)38-28(35-15-7,36-16-8)24(32-12-4)22-20-18-10-2/h23-24H,9-22H2,1-8H3 |
| InChIKey | GUPZZJIMBQISNP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|