C17H37O3P — CID 175262630
dibutyl(1,1,2-triethoxypropyl)phosphane (PubChem CID 175262630) has the molecular formula C17H37O3P and a molecular weight of 320.45 g/mol. Its IUPAC name is dibutyl(1,1,2-triethoxypropyl)phosphane.
| Compound Name | dibutyl(1,1,2-triethoxypropyl)phosphane |
|---|---|
| PubChem CID | 175262630 |
| Molecular Formula | C17H37O3P |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | dibutyl(1,1,2-triethoxypropyl)phosphane |
| SMILES | CCCCP(CCCC)C(OCC)(OCC)C(C)OCC |
| InChI | InChI=1S/C17H37O3P/c1-7-12-14-21(15-13-8-2)17(19-10-4,20-11-5)16(6)18-9-3/h16H,7-15H2,1-6H3 |
| InChIKey | HTSBDMUPVIFFKJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|