C36H78P4 — CID 90109988
dibutyl-[1,1,1-tris(dibutylphosphanyl)butan-2-yl]phosphane (PubChem CID 90109988) has the molecular formula C36H78P4 and a molecular weight of 634.92 g/mol. Its IUPAC name is dibutyl-[1,1,1-tris(dibutylphosphanyl)butan-2-yl]phosphane.
| Compound Name | dibutyl-[1,1,1-tris(dibutylphosphanyl)butan-2-yl]phosphane |
|---|---|
| PubChem CID | 90109988 |
| Molecular Formula | C36H78P4 |
| Molecular Weight | 634.92 g/mol |
| Exact Mass | 634.51 |
| IUPAC Name | dibutyl-[1,1,1-tris(dibutylphosphanyl)butan-2-yl]phosphane |
| SMILES | CCCCP(CCCC)C(CC)C(P(CCCC)CCCC)(P(CCCC)CCCC)P(CCCC)CCCC |
| InChI | InChI=1S/C36H78P4/c1-10-19-27-37(28-20-11-2)35(18-9)36(38(29-21-12-3)30-22-13-4,39(31-23-14-5)32-24-15-6)40(33-25-16-7)34-26-17-8/h35H,10-34H2,1-9H3 |
| InChIKey | HTFCTTCJOFRQJK-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.92 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|