About butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide
butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide (PubChem CID 173222621) has the molecular formula C17H40Br2P2
and a molecular weight of 466.26 g/mol. Its IUPAC name is butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide.
Molecular Properties
| Compound Name | butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide |
| PubChem CID | 173222621 |
| Molecular Formula | C17H40Br2P2 |
| Molecular Weight | 466.26 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide |
| SMILES | Br.Br.CCCCP(CP(CCCC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H38P2.2BrH/c1-9-11-13-18(16(3,4)5)15-19(14-12-10-2)17(6,7)8;;/h9-15H2,1-8H3;2*1H |
| InChIKey | YCNLDHRFVDKJKT-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.26 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide?
The IUPAC name of butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide (CID 173222621) is butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide.
What is the SMILES notation for butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide?
The canonical SMILES for butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide is Br.Br.CCCCP(CP(CCCC)C(C)(C)C)C(C)(C)C.
What is the InChIKey of butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide?
The InChIKey is YCNLDHRFVDKJKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38P2.2BrH/c1-9-11-13-18(16(3,4)5)15-19(14-12-10-2)17(6,7)8;;/h9-15H2,1-8H3;2*1H.
What are the key properties of butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide?
butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide has a molecular weight of 466.26 g/mol, XLogP of 8.26, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-tert-butyl-[[butyl(tert-butyl)phosphanyl]methyl]phosphane;dihydrobromide is sourced from PubChem (CID 173222621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).